C28H24N4O — CID 162293459
2-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]-9-(1-methyl-2H-pyridin-1-ium-2-id-3-yl)carbazole (PubChem CID 162293459) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]-9-(1-methyl-2H-pyridin-1-ium-2-id-3-yl)carbazole.
| Compound Name | 2-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]-9-(1-methyl-2H-pyridin-1-ium-2-id-3-yl)carbazole |
|---|---|
| PubChem CID | 162293459 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]-9-(1-methyl-2H-pyridin-1-ium-2-id-3-yl)carbazole |
| SMILES | CN1C=CN(c2cccc(Oc3ccc4c5ccccc5n(-c5[c-][n+](C)ccc5)c4c3)c2)C1 |
| InChI | InChI=1S/C28H24N4O/c1-29-14-6-8-22(19-29)32-27-11-4-3-10-25(27)26-13-12-24(18-28(26)32)33-23-9-5-7-21(17-23)31-16-15-30(2)20-31/h3-18H,20H2,1-2H3 |
| InChIKey | BOZMTFRWBMVBHA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|