C21H22N4O — CID 140765103
1,4-dimethyl-3-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-2H-imidazol-1-ium-2-ide (PubChem CID 140765103) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1,4-dimethyl-3-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,4-dimethyl-3-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 140765103 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,4-dimethyl-3-[3-[3-(3-methyl-2H-imidazol-1-yl)phenoxy]phenyl]-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1c[n+](C)[c-]n1-c1cccc(Oc2cccc(N3C=CN(C)C3)c2)c1 |
| InChI | InChI=1S/C21H22N4O/c1-17-14-23(3)16-25(17)19-7-5-9-21(13-19)26-20-8-4-6-18(12-20)24-11-10-22(2)15-24/h4-14H,15H2,1-3H3 |
| InChIKey | TXYVEADVJNWJMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|