C28H26N4O — CID 140928852
2-[3-[3-(3,5-dimethyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,4-dimethyl-5-phenylimidazole (PubChem CID 140928852) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[3-[3-(3,5-dimethyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,4-dimethyl-5-phenylimidazole.
| Compound Name | 2-[3-[3-(3,5-dimethyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,4-dimethyl-5-phenylimidazole |
|---|---|
| PubChem CID | 140928852 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[3-[3-(3,5-dimethyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]phenyl]-1,4-dimethyl-5-phenylimidazole |
| SMILES | Cc1nc(-c2cccc(Oc3cccc(-n4[c-][n+](C)cc4C)c3)c2)n(C)c1-c1ccccc1 |
| InChI | InChI=1S/C28H26N4O/c1-20-18-30(3)19-32(20)24-13-9-15-26(17-24)33-25-14-8-12-23(16-25)28-29-21(2)27(31(28)4)22-10-6-5-7-11-22/h5-18H,1-4H3 |
| InChIKey | IFURJJCLRSZETK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|