C14H18N4 — CID 59500315
1-methyl-3-[3-(3-methyl-4,5-dihydroimidazol-1-ium-5-id-1-yl)phenyl]-2H-imidazole (PubChem CID 59500315) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 1-methyl-3-[3-(3-methyl-4,5-dihydroimidazol-1-ium-5-id-1-yl)phenyl]-2H-imidazole.
| Compound Name | 1-methyl-3-[3-(3-methyl-4,5-dihydroimidazol-1-ium-5-id-1-yl)phenyl]-2H-imidazole |
|---|---|
| PubChem CID | 59500315 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-methyl-3-[3-(3-methyl-4,5-dihydroimidazol-1-ium-5-id-1-yl)phenyl]-2H-imidazole |
| SMILES | CN1C=[N+](c2cccc(N3C=CN(C)C3)c2)[CH-]C1 |
| InChI | InChI=1S/C14H18N4/c1-15-6-8-17(11-15)13-4-3-5-14(10-13)18-9-7-16(2)12-18/h3-6,8-10,12H,7,11H2,1-2H3 |
| InChIKey | MPCUORVXTHRFMR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|