potassium piperidin-4-ylsulfonylazanide

C5H11KN2O2S — CID 162305619

IUPACpotassium piperidin-4-ylsulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)C1CCNCC1
InChIInChI=1S/C5H11N2O2S.K/c6-10(8,9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H-,6,8,9);/q-1;+1
InChIKeyPEOZNUKBYQDJIB-UHFFFAOYSA-N
MW202.32 g/mol
LogP-2.88
Rot. Bonds1

About potassium piperidin-4-ylsulfonylazanide

potassium piperidin-4-ylsulfonylazanide (PubChem CID 162305619) has the molecular formula C5H11KN2O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is potassium piperidin-4-ylsulfonylazanide.

Molecular Properties

Compound Namepotassium piperidin-4-ylsulfonylazanide
PubChem CID162305619
Molecular FormulaC5H11KN2O2S
Molecular Weight202.32 g/mol
Exact Mass202.02
IUPAC Namepotassium piperidin-4-ylsulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)C1CCNCC1
InChIInChI=1S/C5H11N2O2S.K/c6-10(8,9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H-,6,8,9);/q-1;+1
InChIKeyPEOZNUKBYQDJIB-UHFFFAOYSA-N
XLogP-2.88
TPSA69.97 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.32
LogP ≤ 5-2.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze potassium piperidin-4-ylsulfonylazanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium piperidin-4-ylsulfonylazanide?
The IUPAC name of potassium piperidin-4-ylsulfonylazanide (CID 162305619) is potassium piperidin-4-ylsulfonylazanide.
What is the SMILES notation for potassium piperidin-4-ylsulfonylazanide?
The canonical SMILES for potassium piperidin-4-ylsulfonylazanide is [K+].[NH-]S(=O)(=O)C1CCNCC1.
What is the InChIKey of potassium piperidin-4-ylsulfonylazanide?
The InChIKey is PEOZNUKBYQDJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2O2S.K/c6-10(8,9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H-,6,8,9);/q-1;+1.
What are the key properties of potassium piperidin-4-ylsulfonylazanide?
potassium piperidin-4-ylsulfonylazanide has a molecular weight of 202.32 g/mol, XLogP of -2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium piperidin-4-ylsulfonylazanide is sourced from PubChem (CID 162305619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).