C5H11KN2O2S — CID 162305619
potassium piperidin-4-ylsulfonylazanide (PubChem CID 162305619) has the molecular formula C5H11KN2O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is potassium piperidin-4-ylsulfonylazanide.
| Compound Name | potassium piperidin-4-ylsulfonylazanide |
|---|---|
| PubChem CID | 162305619 |
| Molecular Formula | C5H11KN2O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | potassium piperidin-4-ylsulfonylazanide |
| SMILES | [K+].[NH-]S(=O)(=O)C1CCNCC1 |
| InChI | InChI=1S/C5H11N2O2S.K/c6-10(8,9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H-,6,8,9);/q-1;+1 |
| InChIKey | PEOZNUKBYQDJIB-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |