About 2-methylpropyl piperidine-4-sulfonate
2-methylpropyl piperidine-4-sulfonate (PubChem CID 177194986) has the molecular formula C9H19NO3S
and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-methylpropyl piperidine-4-sulfonate.
Molecular Properties
| Compound Name | 2-methylpropyl piperidine-4-sulfonate |
| PubChem CID | 177194986 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-methylpropyl piperidine-4-sulfonate |
| SMILES | CC(C)COS(=O)(=O)C1CCNCC1 |
| InChI | InChI=1S/C9H19NO3S/c1-8(2)7-13-14(11,12)9-3-5-10-6-4-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | YZDAXYPOLAHKGT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl piperidine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl piperidine-4-sulfonate?
The IUPAC name of 2-methylpropyl piperidine-4-sulfonate (CID 177194986) is 2-methylpropyl piperidine-4-sulfonate.
What is the SMILES notation for 2-methylpropyl piperidine-4-sulfonate?
The canonical SMILES for 2-methylpropyl piperidine-4-sulfonate is CC(C)COS(=O)(=O)C1CCNCC1.
What is the InChIKey of 2-methylpropyl piperidine-4-sulfonate?
The InChIKey is YZDAXYPOLAHKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S/c1-8(2)7-13-14(11,12)9-3-5-10-6-4-9/h8-10H,3-7H2,1-2H3.
What are the key properties of 2-methylpropyl piperidine-4-sulfonate?
2-methylpropyl piperidine-4-sulfonate has a molecular weight of 221.32 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl piperidine-4-sulfonate is sourced from PubChem (CID 177194986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).