About (Z)-but-2-enedioic acid;3H-quinolin-2-one
(Z)-but-2-enedioic acid;3H-quinolin-2-one (PubChem CID 162307464) has the molecular formula C13H11NO5
and a molecular weight of 261.23 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3H-quinolin-2-one.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;3H-quinolin-2-one |
| PubChem CID | 162307464 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (Z)-but-2-enedioic acid;3H-quinolin-2-one |
| SMILES | O=C(O)/C=C\C(=O)O.O=C1CC=c2ccccc2=N1 |
| InChI | InChI=1S/C9H7NO.C4H4O4/c11-9-6-5-7-3-1-2-4-8(7)10-9;5-3(6)1-2-4(7)8/h1-5H,6H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OUHYMVDZBOQJNA-BTJKTKAUSA-N |
| XLogP | -0.27 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;3H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;3H-quinolin-2-one?
The IUPAC name of (Z)-but-2-enedioic acid;3H-quinolin-2-one (CID 162307464) is (Z)-but-2-enedioic acid;3H-quinolin-2-one.
What is the SMILES notation for (Z)-but-2-enedioic acid;3H-quinolin-2-one?
The canonical SMILES for (Z)-but-2-enedioic acid;3H-quinolin-2-one is O=C(O)/C=C\C(=O)O.O=C1CC=c2ccccc2=N1.
What is the InChIKey of (Z)-but-2-enedioic acid;3H-quinolin-2-one?
The InChIKey is OUHYMVDZBOQJNA-BTJKTKAUSA-N. The full InChI is InChI=1S/C9H7NO.C4H4O4/c11-9-6-5-7-3-1-2-4-8(7)10-9;5-3(6)1-2-4(7)8/h1-5H,6H2;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;3H-quinolin-2-one?
(Z)-but-2-enedioic acid;3H-quinolin-2-one has a molecular weight of 261.23 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;3H-quinolin-2-one is sourced from PubChem (CID 162307464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).