C23H29FN2O2Sn — CID 162308113
[6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-dimethylstannane (PubChem CID 162308113) has the molecular formula C23H29FN2O2Sn and a molecular weight of 503.21 g/mol. Its IUPAC name is [6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-dimethylstannane.
| Compound Name | [6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-dimethylstannane |
|---|---|
| PubChem CID | 162308113 |
| Molecular Formula | C23H29FN2O2Sn |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-dimethylstannane |
| SMILES | CCc1cc(OC)c(F)cc1-c1ccc2c([SnH](C)C)nn(C3CCCCO3)c2c1 |
| InChI | InChI=1S/C21H22FN2O2.2CH3.Sn.H/c1-3-14-11-20(25-2)18(22)12-17(14)15-7-8-16-13-23-24(19(16)10-15)21-6-4-5-9-26-21;;;;/h7-8,10-12,21H,3-6,9H2,1-2H3;2*1H3;; |
| InChIKey | CQYGVXJBGHFHRX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |