C19H17FN6O — CID 170648947
5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-(2H-triazol-4-yl)indazole (PubChem CID 170648947) has the molecular formula C19H17FN6O and a molecular weight of 364.38 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-(2H-triazol-4-yl)indazole.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-(2H-triazol-4-yl)indazole |
|---|---|
| PubChem CID | 170648947 |
| Molecular Formula | C19H17FN6O |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-(2H-triazol-4-yl)indazole |
| SMILES | Fc1ncccc1-c1ccc2c(c1)c(-c1cn[nH]n1)nn2C1CCCCO1 |
| InChI | InChI=1S/C19H17FN6O/c20-19-13(4-3-8-21-19)12-6-7-16-14(10-12)18(15-11-22-25-23-15)24-26(16)17-5-1-2-9-27-17/h3-4,6-8,10-11,17H,1-2,5,9H2,(H,22,23,25) |
| InChIKey | HAROMTCYWDYPOL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|