C30H28FN7O2 — CID 170649118
1-[7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 170649118) has the molecular formula C30H28FN7O2 and a molecular weight of 537.60 g/mol. Its IUPAC name is 1-[7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 1-[7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 170649118 |
| Molecular Formula | C30H28FN7O2 |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-[7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CC(=O)N1CCc2ccc(-n3cc(-c4nn(C5CCCCO5)c5ccc(-c6cccnc6F)cc45)nn3)cc2C1 |
| InChI | InChI=1S/C30H28FN7O2/c1-19(39)36-13-11-20-7-9-23(15-22(20)17-36)37-18-26(33-35-37)29-25-16-21(24-5-4-12-32-30(24)31)8-10-27(25)38(34-29)28-6-2-3-14-40-28/h4-5,7-10,12,15-16,18,28H,2-3,6,11,13-14,17H2,1H3 |
| InChIKey | HYUVLGYONYLSSS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|