C24H42O11S — CID 162308281
(E)-but-2-enedioic acid;2,2-dioctyl-3-sulfobutanedioic acid (PubChem CID 162308281) has the molecular formula C24H42O11S and a molecular weight of 538.66 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2,2-dioctyl-3-sulfobutanedioic acid.
| Compound Name | (E)-but-2-enedioic acid;2,2-dioctyl-3-sulfobutanedioic acid |
|---|---|
| PubChem CID | 162308281 |
| Molecular Formula | C24H42O11S |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (E)-but-2-enedioic acid;2,2-dioctyl-3-sulfobutanedioic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(=O)O)C(C(=O)O)S(=O)(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H38O7S.C4H4O4/c1-3-5-7-9-11-13-15-20(19(23)24,16-14-12-10-8-6-4-2)17(18(21)22)28(25,26)27;5-3(6)1-2-4(7)8/h17H,3-16H2,1-2H3,(H,21,22)(H,23,24)(H,25,26,27);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FBILZYXLYISFAL-WLHGVMLRSA-N |
| XLogP | 4.61 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|