C20H38NaO7S — CID 87087473
CID 87087473 (PubChem CID 87087473) has the molecular formula C20H38NaO7S and a molecular weight of 445.57 g/mol.
| Compound Name | CID 87087473 |
|---|---|
| PubChem CID | 87087473 |
| Molecular Formula | C20H38NaO7S |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(=O)O)C(C(=O)O)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C20H38O7S.Na/c1-3-5-7-9-11-13-15-20(19(23)24,16-14-12-10-8-6-4-2)17(18(21)22)28(25,26)27;/h17H,3-16H2,1-2H3,(H,21,22)(H,23,24)(H,25,26,27); |
| InChIKey | UMGUNMWNUUADJH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|