acetic acid;1-azabicyclo[2.2.2]octan-2-one

C9H15NO3 — CID 162310710

IUPACacetic acid;1-azabicyclo[2.2.2]octan-2-one
SMILESCC(=O)O.O=C1CC2CCN1CC2
InChIInChI=1S/C7H11NO.C2H4O2/c9-7-5-6-1-3-8(7)4-2-6;1-2(3)4/h6H,1-5H2;1H3,(H,3,4)
InChIKeyAZZRLYMYDLCMOX-UHFFFAOYSA-N
MW185.22 g/mol
LogP0.72
Rot. Bonds

About acetic acid;1-azabicyclo[2.2.2]octan-2-one

acetic acid;1-azabicyclo[2.2.2]octan-2-one (PubChem CID 162310710) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is acetic acid;1-azabicyclo[2.2.2]octan-2-one.

Molecular Properties

Compound Nameacetic acid;1-azabicyclo[2.2.2]octan-2-one
PubChem CID162310710
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Nameacetic acid;1-azabicyclo[2.2.2]octan-2-one
SMILESCC(=O)O.O=C1CC2CCN1CC2
InChIInChI=1S/C7H11NO.C2H4O2/c9-7-5-6-1-3-8(7)4-2-6;1-2(3)4/h6H,1-5H2;1H3,(H,3,4)
InChIKeyAZZRLYMYDLCMOX-UHFFFAOYSA-N
XLogP0.72
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze acetic acid;1-azabicyclo[2.2.2]octan-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-azabicyclo[2.2.2]octan-2-one?
The IUPAC name of acetic acid;1-azabicyclo[2.2.2]octan-2-one (CID 162310710) is acetic acid;1-azabicyclo[2.2.2]octan-2-one.
What is the SMILES notation for acetic acid;1-azabicyclo[2.2.2]octan-2-one?
The canonical SMILES for acetic acid;1-azabicyclo[2.2.2]octan-2-one is CC(=O)O.O=C1CC2CCN1CC2.
What is the InChIKey of acetic acid;1-azabicyclo[2.2.2]octan-2-one?
The InChIKey is AZZRLYMYDLCMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C2H4O2/c9-7-5-6-1-3-8(7)4-2-6;1-2(3)4/h6H,1-5H2;1H3,(H,3,4).
What are the key properties of acetic acid;1-azabicyclo[2.2.2]octan-2-one?
acetic acid;1-azabicyclo[2.2.2]octan-2-one has a molecular weight of 185.22 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-azabicyclo[2.2.2]octan-2-one is sourced from PubChem (CID 162310710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).