About pyrido[2,3-h][3]benzazepin-2-one;hydrochloride
pyrido[2,3-h][3]benzazepin-2-one;hydrochloride (PubChem CID 162321168) has the molecular formula C13H9ClN2O
and a molecular weight of 244.68 g/mol. Its IUPAC name is pyrido[2,3-h][3]benzazepin-2-one;hydrochloride.
Molecular Properties
| Compound Name | pyrido[2,3-h][3]benzazepin-2-one;hydrochloride |
| PubChem CID | 162321168 |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | pyrido[2,3-h][3]benzazepin-2-one;hydrochloride |
| SMILES | Cl.O=c1ccc2cc3ccnccc3cc2n1 |
| InChI | InChI=1S/C13H8N2O.ClH/c16-13-2-1-11-7-9-3-5-14-6-4-10(9)8-12(11)15-13;/h1-8H;1H |
| InChIKey | FQQYPDXXCRVYSV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrido[2,3-h][3]benzazepin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-h][3]benzazepin-2-one;hydrochloride?
The IUPAC name of pyrido[2,3-h][3]benzazepin-2-one;hydrochloride (CID 162321168) is pyrido[2,3-h][3]benzazepin-2-one;hydrochloride.
What is the SMILES notation for pyrido[2,3-h][3]benzazepin-2-one;hydrochloride?
The canonical SMILES for pyrido[2,3-h][3]benzazepin-2-one;hydrochloride is Cl.O=c1ccc2cc3ccnccc3cc2n1.
What is the InChIKey of pyrido[2,3-h][3]benzazepin-2-one;hydrochloride?
The InChIKey is FQQYPDXXCRVYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O.ClH/c16-13-2-1-11-7-9-3-5-14-6-4-10(9)8-12(11)15-13;/h1-8H;1H.
What are the key properties of pyrido[2,3-h][3]benzazepin-2-one;hydrochloride?
pyrido[2,3-h][3]benzazepin-2-one;hydrochloride has a molecular weight of 244.68 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-h][3]benzazepin-2-one;hydrochloride is sourced from PubChem (CID 162321168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).