C26H25F4N3O6 — CID 162328219
(2R,3R)-2,3-dihydroxybutanedioic acid;5-(4-fluorophenyl)-2-methyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 162328219) has the molecular formula C26H25F4N3O6 and a molecular weight of 551.49 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;5-(4-fluorophenyl)-2-methyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;5-(4-fluorophenyl)-2-methyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 162328219 |
| Molecular Formula | C26H25F4N3O6 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;5-(4-fluorophenyl)-2-methyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | CN1CCC(c2ccc(F)cc2)c2ccc(-c3ccc(C(F)(F)F)nn3)cc2C1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C22H19F4N3.C4H6O6/c1-29-11-10-19(14-2-5-17(23)6-3-14)18-7-4-15(12-16(18)13-29)20-8-9-21(28-27-20)22(24,25)26;5-1(3(7)8)2(6)4(9)10/h2-9,12,19H,10-11,13H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | QCYBZOFFTTXCNT-LREBCSMRSA-N |
| XLogP | 3.15 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |