C28H28N2O6 — CID 162318394
(2R,3R)-2,3-dihydroxybutanedioic acid;3-(2-methyl-5-phenyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)benzonitrile (PubChem CID 162318394) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;3-(2-methyl-5-phenyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)benzonitrile.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;3-(2-methyl-5-phenyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)benzonitrile |
|---|---|
| PubChem CID | 162318394 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;3-(2-methyl-5-phenyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)benzonitrile |
| SMILES | CN1CCC(c2ccccc2)c2ccc(-c3cccc(C#N)c3)cc2C1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C24H22N2.C4H6O6/c1-26-13-12-24(19-7-3-2-4-8-19)23-11-10-21(15-22(23)17-26)20-9-5-6-18(14-20)16-25;5-1(3(7)8)2(6)4(9)10/h2-11,14-15,24H,12-13,17H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | OIYBUCNYZURTFY-LREBCSMRSA-N |
| XLogP | 3.07 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |