acetic acid;5,7-dichloro-1H-indole

C10H9Cl2NO2 — CID 162328874

IUPACacetic acid;5,7-dichloro-1H-indole
SMILESCC(=O)O.Clc1cc(Cl)c2[nH]ccc2c1
InChIInChI=1S/C8H5Cl2N.C2H4O2/c9-6-3-5-1-2-11-8(5)7(10)4-6;1-2(3)4/h1-4,11H;1H3,(H,3,4)
InChIKeyCGYZMUROPCRENZ-UHFFFAOYSA-N
MW246.09 g/mol
LogP3.57
Rot. Bonds

About acetic acid;5,7-dichloro-1H-indole

acetic acid;5,7-dichloro-1H-indole (PubChem CID 162328874) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is acetic acid;5,7-dichloro-1H-indole.

Molecular Properties

Compound Nameacetic acid;5,7-dichloro-1H-indole
PubChem CID162328874
Molecular FormulaC10H9Cl2NO2
Molecular Weight246.09 g/mol
Exact Mass245.00
IUPAC Nameacetic acid;5,7-dichloro-1H-indole
SMILESCC(=O)O.Clc1cc(Cl)c2[nH]ccc2c1
InChIInChI=1S/C8H5Cl2N.C2H4O2/c9-6-3-5-1-2-11-8(5)7(10)4-6;1-2(3)4/h1-4,11H;1H3,(H,3,4)
InChIKeyCGYZMUROPCRENZ-UHFFFAOYSA-N
XLogP3.57
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.09
LogP ≤ 53.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze acetic acid;5,7-dichloro-1H-indole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;5,7-dichloro-1H-indole?
The IUPAC name of acetic acid;5,7-dichloro-1H-indole (CID 162328874) is acetic acid;5,7-dichloro-1H-indole.
What is the SMILES notation for acetic acid;5,7-dichloro-1H-indole?
The canonical SMILES for acetic acid;5,7-dichloro-1H-indole is CC(=O)O.Clc1cc(Cl)c2[nH]ccc2c1.
What is the InChIKey of acetic acid;5,7-dichloro-1H-indole?
The InChIKey is CGYZMUROPCRENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N.C2H4O2/c9-6-3-5-1-2-11-8(5)7(10)4-6;1-2(3)4/h1-4,11H;1H3,(H,3,4).
What are the key properties of acetic acid;5,7-dichloro-1H-indole?
acetic acid;5,7-dichloro-1H-indole has a molecular weight of 246.09 g/mol, XLogP of 3.57, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;5,7-dichloro-1H-indole is sourced from PubChem (CID 162328874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).