C10H9Cl2NO2 — CID 162328874
acetic acid;5,7-dichloro-1H-indole (PubChem CID 162328874) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is acetic acid;5,7-dichloro-1H-indole.
| Compound Name | acetic acid;5,7-dichloro-1H-indole |
|---|---|
| PubChem CID | 162328874 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | acetic acid;5,7-dichloro-1H-indole |
| SMILES | CC(=O)O.Clc1cc(Cl)c2[nH]ccc2c1 |
| InChI | InChI=1S/C8H5Cl2N.C2H4O2/c9-6-3-5-1-2-11-8(5)7(10)4-6;1-2(3)4/h1-4,11H;1H3,(H,3,4) |
| InChIKey | CGYZMUROPCRENZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |