C17H21Cl2N8O- — CID 162330319
3,5-diamino-N-[N'-[(3S)-1-benzylpyrrolidin-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide chloride (PubChem CID 162330319) has the molecular formula C17H21Cl2N8O- and a molecular weight of 424.32 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[(3S)-1-benzylpyrrolidin-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-N-[N'-[(3S)-1-benzylpyrrolidin-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 162330319 |
| Molecular Formula | C17H21Cl2N8O- |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3,5-diamino-N-[N'-[(3S)-1-benzylpyrrolidin-3-yl]carbamimidoyl]-6-chloropyrazine-2-carboxamide chloride |
| SMILES | N/C(=N\[C@H]1CCN(Cc2ccccc2)C1)NC(=O)c1nc(Cl)c(N)nc1N.[Cl-] |
| InChI | InChI=1S/C17H21ClN8O.ClH/c18-13-15(20)24-14(19)12(23-13)16(27)25-17(21)22-11-6-7-26(9-11)8-10-4-2-1-3-5-10;/h1-5,11H,6-9H2,(H4,19,20,24)(H3,21,22,25,27);1H/p-1/t11-;/m0./s1 |
| InChIKey | QWXLBZNSPZKUDY-MERQFXBCSA-M |
| XLogP | -2.38 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|