C21H27ClN8O3 — CID 138599215
methyl 3-[[3-[[N-(3,5-diamino-6-chloropyrazine-2-carbonyl)-N'-methylcarbamimidoyl]amino]piperidin-1-yl]methyl]benzoate (PubChem CID 138599215) has the molecular formula C21H27ClN8O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is methyl 3-[[3-[[N-(3,5-diamino-6-chloropyrazine-2-carbonyl)-N'-methylcarbamimidoyl]amino]piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-[[N-(3,5-diamino-6-chloropyrazine-2-carbonyl)-N'-methylcarbamimidoyl]amino]piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 138599215 |
| Molecular Formula | C21H27ClN8O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | methyl 3-[[3-[[N-(3,5-diamino-6-chloropyrazine-2-carbonyl)-N'-methylcarbamimidoyl]amino]piperidin-1-yl]methyl]benzoate |
| SMILES | C/N=C(/NC(=O)c1nc(Cl)c(N)nc1N)NC1CCCN(Cc2cccc(C(=O)OC)c2)C1 |
| InChI | InChI=1S/C21H27ClN8O3/c1-25-21(29-19(31)15-17(23)28-18(24)16(22)27-15)26-14-7-4-8-30(11-14)10-12-5-3-6-13(9-12)20(32)33-2/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3,(H4,23,24,28)(H2,25,26,29,31) |
| InChIKey | SSACZKIVIFUFRL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|