C21H28ClN8O3+ — CID 90073585
methyl 3-[[3-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]-1-methylpiperidin-1-ium-1-yl]methyl]benzoate (PubChem CID 90073585) has the molecular formula C21H28ClN8O3+ and a molecular weight of 475.96 g/mol. Its IUPAC name is methyl 3-[[3-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]-1-methylpiperidin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]-1-methylpiperidin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 90073585 |
| Molecular Formula | C21H28ClN8O3+ |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | methyl 3-[[3-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]-1-methylpiperidin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[N+]2(C)CCCC(/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)C2)c1 |
| InChI | InChI=1S/C21H27ClN8O3/c1-30(10-12-5-3-6-13(9-12)20(32)33-2)8-4-7-14(11-30)26-21(25)29-19(31)15-17(23)28-18(24)16(22)27-15/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3,(H6-,23,24,25,26,28,29,31)/p+1 |
| InChIKey | QNQZBVHAXKXVQV-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 171.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|