C21H28Cl2N12O2 — CID 59864306
3,5-diamino-N-[N'-[4-[[[amino-[(2,4-diamino-5-chlorobenzoyl)amino]methylidene]amino]methyl]cyclohexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59864306) has the molecular formula C21H28Cl2N12O2 and a molecular weight of 551.44 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[[[amino-[(2,4-diamino-5-chlorobenzoyl)amino]methylidene]amino]methyl]cyclohexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[[[amino-[(2,4-diamino-5-chlorobenzoyl)amino]methylidene]amino]methyl]cyclohexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59864306 |
| Molecular Formula | C21H28Cl2N12O2 |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[[[amino-[(2,4-diamino-5-chlorobenzoyl)amino]methylidene]amino]methyl]cyclohexyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CC1CCC(/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1)NC(=O)c1cc(Cl)c(N)cc1N |
| InChI | InChI=1S/C21H28Cl2N12O2/c22-11-5-10(12(24)6-13(11)25)18(36)34-20(28)30-7-8-1-3-9(4-2-8)31-21(29)35-19(37)14-16(26)33-17(27)15(23)32-14/h5-6,8-9H,1-4,7,24-25H2,(H4,26,27,33)(H3,28,30,34,36)(H3,29,31,35,37) |
| InChIKey | VTFHAQIGPYAGMC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 264.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|