C21H28Cl2N8O2 — CID 90073393
3,5-diamino-6-chloro-N-[N'-[(3S)-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride (PubChem CID 90073393) has the molecular formula C21H28Cl2N8O2 and a molecular weight of 495.42 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 90073393 |
| Molecular Formula | C21H28Cl2N8O2 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[(3S)-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]carbamimidoyl]pyrazine-2-carboxamide chloride |
| SMILES | COc1ccc(C[N+]23CCC(CC2)[C@H](/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)C3)cc1.[Cl-] |
| InChI | InChI=1S/C21H27ClN8O2.ClH/c1-32-14-4-2-12(3-5-14)10-30-8-6-13(7-9-30)15(11-30)26-21(25)29-20(31)16-18(23)28-19(24)17(22)27-16;/h2-5,13,15H,6-11H2,1H3,(H6-,23,24,25,26,28,29,31);1H/t13?,15-,30?;/m1./s1 |
| InChIKey | GKTIBYMNBMYGJD-LCOWWDMOSA-N |
| XLogP | -1.84 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|