C16H26ClN3O — CID 162332633
[2-[(2-cyclohexylethylamino)methyl]phenyl]urea;hydrochloride (PubChem CID 162332633) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is [2-[(2-cyclohexylethylamino)methyl]phenyl]urea;hydrochloride.
| Compound Name | [2-[(2-cyclohexylethylamino)methyl]phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 162332633 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | [2-[(2-cyclohexylethylamino)methyl]phenyl]urea;hydrochloride |
| SMILES | Cl.NC(=O)Nc1ccccc1CNCCC1CCCCC1 |
| InChI | InChI=1S/C16H25N3O.ClH/c17-16(20)19-15-9-5-4-8-14(15)12-18-11-10-13-6-2-1-3-7-13;/h4-5,8-9,13,18H,1-3,6-7,10-12H2,(H3,17,19,20);1H |
| InChIKey | SBHKSAPBOTWANQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|