C18H32ClNSi — CID 156624699
2-cyclohexyl-N-[(2-trimethylsilylphenyl)methyl]ethanamine;hydrochloride (PubChem CID 156624699) has the molecular formula C18H32ClNSi and a molecular weight of 326.00 g/mol. Its IUPAC name is 2-cyclohexyl-N-[(2-trimethylsilylphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-cyclohexyl-N-[(2-trimethylsilylphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 156624699 |
| Molecular Formula | C18H32ClNSi |
| Molecular Weight | 326.00 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-cyclohexyl-N-[(2-trimethylsilylphenyl)methyl]ethanamine;hydrochloride |
| SMILES | C[Si](C)(C)c1ccccc1CNCCC1CCCCC1.Cl |
| InChI | InChI=1S/C18H31NSi.ClH/c1-20(2,3)18-12-8-7-11-17(18)15-19-14-13-16-9-5-4-6-10-16;/h7-8,11-12,16,19H,4-6,9-10,13-15H2,1-3H3;1H |
| InChIKey | DVYIRGDXJAMJLL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|