About lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine
lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine (PubChem CID 162333767) has the molecular formula C15H25LiN+
and a molecular weight of 226.31 g/mol. Its IUPAC name is lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine |
| PubChem CID | 162333767 |
| Molecular Formula | C15H25LiN+ |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.21 |
| IUPAC Name | lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine |
| SMILES | CCCCCCc1ccc(CN(C)C)cc1.[Li+] |
| InChI | InChI=1S/C15H25N.Li/c1-4-5-6-7-8-14-9-11-15(12-10-14)13-16(2)3;/h9-12H,4-8,13H2,1-3H3;/q;+1 |
| InChIKey | IORMOJIYPLLXOQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine?
The IUPAC name of lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine (CID 162333767) is lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine.
What is the SMILES notation for lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine?
The canonical SMILES for lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine is CCCCCCc1ccc(CN(C)C)cc1.[Li+].
What is the InChIKey of lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine?
The InChIKey is IORMOJIYPLLXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N.Li/c1-4-5-6-7-8-14-9-11-15(12-10-14)13-16(2)3;/h9-12H,4-8,13H2,1-3H3;/q;+1.
What are the key properties of lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine?
lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine has a molecular weight of 226.31 g/mol, XLogP of 0.88, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-(4-hexylphenyl)-N,N-dimethylmethanamine is sourced from PubChem (CID 162333767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).