C34H25BrF7OP — CID 162333834
[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-fluorophenyl]methyl-triphenylphosphanium bromide (PubChem CID 162333834) has the molecular formula C34H25BrF7OP and a molecular weight of 693.44 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-fluorophenyl]methyl-triphenylphosphanium bromide.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-fluorophenyl]methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 162333834 |
| Molecular Formula | C34H25BrF7OP |
| Molecular Weight | 693.44 g/mol |
| Exact Mass | 692.07 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-fluorophenyl]methyl-triphenylphosphanium bromide |
| SMILES | Fc1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C34H25F7OP.BrH/c35-28-16-17-32(42-22-24-18-26(33(36,37)38)21-27(19-24)34(39,40)41)25(20-28)23-43(29-10-4-1-5-11-29,30-12-6-2-7-13-30)31-14-8-3-9-15-31;/h1-21H,22-23H2;1H/q+1;/p-1 |
| InChIKey | KFZXINYEQLPSRZ-UHFFFAOYSA-M |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|