C26H20F4P+ — CID 158973128
[2-fluoro-4-(trifluoromethyl)phenyl]methyl-triphenylphosphanium (PubChem CID 158973128) has the molecular formula C26H20F4P+ and a molecular weight of 439.41 g/mol. Its IUPAC name is [2-fluoro-4-(trifluoromethyl)phenyl]methyl-triphenylphosphanium.
| Compound Name | [2-fluoro-4-(trifluoromethyl)phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 158973128 |
| Molecular Formula | C26H20F4P+ |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-fluoro-4-(trifluoromethyl)phenyl]methyl-triphenylphosphanium |
| SMILES | Fc1cc(C(F)(F)F)ccc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20F4P/c27-25-18-21(26(28,29)30)17-16-20(25)19-31(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-18H,19H2/q+1 |
| InChIKey | JOBHXGXMOMZWJR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|