C31H23ClF4NOP — CID 155093369
[2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl-triphenylphosphanium chloride (PubChem CID 155093369) has the molecular formula C31H23ClF4NOP and a molecular weight of 567.95 g/mol. Its IUPAC name is [2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl-triphenylphosphanium chloride.
| Compound Name | [2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 155093369 |
| Molecular Formula | C31H23ClF4NOP |
| Molecular Weight | 567.95 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl-triphenylphosphanium chloride |
| SMILES | Fc1cc(C(F)(F)F)ccc1C=Cc1nc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)co1.[Cl-] |
| InChI | InChI=1S/C31H23F4NOP.ClH/c32-29-20-24(31(33,34)35)18-16-23(29)17-19-30-36-25(21-37-30)22-38(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28;/h1-21H,22H2;1H/q+1;/p-1 |
| InChIKey | USXKHRFAWSKQIY-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|