C13H9ClFNO3 — CID 155093397
4-[(E)-2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoic acid (PubChem CID 155093397) has the molecular formula C13H9ClFNO3 and a molecular weight of 281.67 g/mol. Its IUPAC name is 4-[(E)-2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(E)-2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 155093397 |
| Molecular Formula | C13H9ClFNO3 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-[(E)-2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/c2nc(CCl)co2)c(F)c1 |
| InChI | InChI=1S/C13H9ClFNO3/c14-6-10-7-19-12(16-10)4-3-8-1-2-9(13(17)18)5-11(8)15/h1-5,7H,6H2,(H,17,18)/b4-3+ |
| InChIKey | KLDSROMFGQUVOT-ONEGZZNKSA-N |
| XLogP | 3.42 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|