C30H23BrF2O4 — CID 159443762
4-bromo-3-fluorobenzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid;styrene (PubChem CID 159443762) has the molecular formula C30H23BrF2O4 and a molecular weight of 565.41 g/mol. Its IUPAC name is 4-bromo-3-fluorobenzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid;styrene.
| Compound Name | 4-bromo-3-fluorobenzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid;styrene |
|---|---|
| PubChem CID | 159443762 |
| Molecular Formula | C30H23BrF2O4 |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 4-bromo-3-fluorobenzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid;styrene |
| SMILES | C=Cc1ccccc1.O=C(O)c1ccc(/C=C/c2ccccc2)c(F)c1.O=C(O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H11FO2.C8H8.C7H4BrFO2/c16-14-10-13(15(17)18)9-8-12(14)7-6-11-4-2-1-3-5-11;1-2-8-6-4-3-5-7-8;8-5-2-1-4(7(10)11)3-6(5)9/h1-10H,(H,17,18);2-7H,1H2;1-3H,(H,10,11)/b7-6+;; |
| InChIKey | LSMPTOICZBDRFY-KMXZHCNGSA-N |
| XLogP | 8.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|