C24H21F4N5O2 — CID 155093404
2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(tetrazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 155093404) has the molecular formula C24H21F4N5O2 and a molecular weight of 487.46 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(tetrazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole.
| Compound Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(tetrazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 155093404 |
| Molecular Formula | C24H21F4N5O2 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(tetrazol-2-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | Fc1cc(C(F)(F)F)ccc1C=Cc1nc(COc2ccc(CCCCn3ncnn3)cc2)co1 |
| InChI | InChI=1S/C24H21F4N5O2/c25-22-13-19(24(26,27)28)8-6-18(22)7-11-23-31-20(15-35-23)14-34-21-9-4-17(5-10-21)3-1-2-12-33-30-16-29-32-33/h4-11,13,15-16H,1-3,12,14H2 |
| InChIKey | FNYYKMUIWGYYLO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|