C26H23F4N3O2 — CID 155093363
2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-(4-pyrazol-1-ylbutyl)phenoxy]methyl]-1,3-oxazole (PubChem CID 155093363) has the molecular formula C26H23F4N3O2 and a molecular weight of 485.48 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-(4-pyrazol-1-ylbutyl)phenoxy]methyl]-1,3-oxazole.
| Compound Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-(4-pyrazol-1-ylbutyl)phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 155093363 |
| Molecular Formula | C26H23F4N3O2 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-(4-pyrazol-1-ylbutyl)phenoxy]methyl]-1,3-oxazole |
| SMILES | Fc1cc(C(F)(F)F)ccc1C=Cc1nc(COc2ccc(CCCCn3cccn3)cc2)co1 |
| InChI | InChI=1S/C26H23F4N3O2/c27-24-16-21(26(28,29)30)9-7-20(24)8-12-25-32-22(18-35-25)17-34-23-10-5-19(6-11-23)4-1-2-14-33-15-3-13-31-33/h3,5-13,15-16,18H,1-2,4,14,17H2 |
| InChIKey | LIOSOFQOKNPCOT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|