C23H22FN5O2 — CID 142575697
2-[(E)-2-(3-fluoro-2-pyridinyl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 142575697) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-[(E)-2-(3-fluoro-2-pyridinyl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole.
| Compound Name | 2-[(E)-2-(3-fluoro-2-pyridinyl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 142575697 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[(E)-2-(3-fluoro-2-pyridinyl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | Fc1cccnc1/C=C/c1nc(COc2ccc(CCCCn3ccnn3)cc2)co1 |
| InChI | InChI=1S/C23H22FN5O2/c24-21-5-3-12-25-22(21)10-11-23-27-19(17-31-23)16-30-20-8-6-18(7-9-20)4-1-2-14-29-15-13-26-28-29/h3,5-13,15,17H,1-2,4,14,16H2/b11-10+ |
| InChIKey | YLWPURUOYHJBAI-ZHACJKMWSA-N |
| XLogP | 4.57 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|