C25H22F2N4O4 — CID 11260158
2-[(E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 11260158) has the molecular formula C25H22F2N4O4 and a molecular weight of 480.47 g/mol. Its IUPAC name is 2-[(E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole.
| Compound Name | 2-[(E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11260158 |
| Molecular Formula | C25H22F2N4O4 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[(E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | FC1(F)Oc2ccc(/C=C/c3nc(COc4ccc(CCCCn5ccnn5)cc4)co3)cc2O1 |
| InChI | InChI=1S/C25H22F2N4O4/c26-25(27)34-22-10-6-19(15-23(22)35-25)7-11-24-29-20(17-33-24)16-32-21-8-4-18(5-9-21)3-1-2-13-31-14-12-28-30-31/h4-12,14-15,17H,1-3,13,16H2/b11-7+ |
| InChIKey | PECVIKIAIDUZFC-YRNVUSSQSA-N |
| XLogP | 5.36 |
| TPSA | 84.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|