C25H22F4N4O2 — CID 69423438
2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 69423438) has the molecular formula C25H22F4N4O2 and a molecular weight of 486.47 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole.
| Compound Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 69423438 |
| Molecular Formula | C25H22F4N4O2 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | Fc1cc(C(F)(F)F)ccc1C=Cc1nc(COc2ccc(CCCCn3ccnn3)cc2)co1 |
| InChI | InChI=1S/C25H22F4N4O2/c26-23-15-20(25(27,28)29)8-6-19(23)7-11-24-31-21(17-35-24)16-34-22-9-4-18(5-10-22)3-1-2-13-33-14-12-30-32-33/h4-12,14-15,17H,1-3,13,16H2 |
| InChIKey | ULZDVGGLBAVJTO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|