C26H27N5O3 — CID 69487294
N-[[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-oxazol-4-yl]methyl]-N-methyl-4-[4-(triazol-1-yl)butyl]aniline (PubChem CID 69487294) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-oxazol-4-yl]methyl]-N-methyl-4-[4-(triazol-1-yl)butyl]aniline.
| Compound Name | N-[[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-oxazol-4-yl]methyl]-N-methyl-4-[4-(triazol-1-yl)butyl]aniline |
|---|---|
| PubChem CID | 69487294 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-oxazol-4-yl]methyl]-N-methyl-4-[4-(triazol-1-yl)butyl]aniline |
| SMILES | CN(Cc1coc(C=Cc2ccc3c(c2)OCO3)n1)c1ccc(CCCCn2ccnn2)cc1 |
| InChI | InChI=1S/C26H27N5O3/c1-30(23-9-5-20(6-10-23)4-2-3-14-31-15-13-27-29-31)17-22-18-32-26(28-22)12-8-21-7-11-24-25(16-21)34-19-33-24/h5-13,15-16,18H,2-4,14,17,19H2,1H3 |
| InChIKey | IGQKNWIFDDDYRJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|