C14H11ClFNO3 — CID 175065509
methyl 4-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoate (PubChem CID 175065509) has the molecular formula C14H11ClFNO3 and a molecular weight of 295.70 g/mol. Its IUPAC name is methyl 4-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 175065509 |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | methyl 4-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C=Cc2nc(CCl)co2)c(F)c1 |
| InChI | InChI=1S/C14H11ClFNO3/c1-19-14(18)10-3-2-9(12(16)6-10)4-5-13-17-11(7-15)8-20-13/h2-6,8H,7H2,1H3 |
| InChIKey | TZUSOCLYCLXOGI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|