C13H9ClF3NOS — CID 173171715
2-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-5-(trifluoromethyl)benzenethiol (PubChem CID 173171715) has the molecular formula C13H9ClF3NOS and a molecular weight of 319.74 g/mol. Its IUPAC name is 2-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-5-(trifluoromethyl)benzenethiol.
| Compound Name | 2-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-5-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 173171715 |
| Molecular Formula | C13H9ClF3NOS |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-[2-[4-(chloromethyl)-1,3-oxazol-2-yl]ethenyl]-5-(trifluoromethyl)benzenethiol |
| SMILES | FC(F)(F)c1ccc(C=Cc2nc(CCl)co2)c(S)c1 |
| InChI | InChI=1S/C13H9ClF3NOS/c14-6-10-7-19-12(18-10)4-2-8-1-3-9(5-11(8)20)13(15,16)17/h1-5,7,20H,6H2 |
| InChIKey | VFCHOPOUWQZABX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|