C13H9ClF3NO2S — CID 18453538
4-(chloromethyl)-2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazole (PubChem CID 18453538) has the molecular formula C13H9ClF3NO2S and a molecular weight of 335.73 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 18453538 |
| Molecular Formula | C13H9ClF3NO2S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-(chloromethyl)-2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazole |
| SMILES | O=S(c1ccc(/C=C/c2nc(CCl)co2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3NO2S/c14-7-10-8-20-12(18-10)6-3-9-1-4-11(5-2-9)21(19)13(15,16)17/h1-6,8H,7H2/b6-3+ |
| InChIKey | BQYPBSRRCLNVOI-ZZXKWVIFSA-N |
| XLogP | 4.21 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|