C20H14F3NO4S — CID 86600560
4-[[2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde (PubChem CID 86600560) has the molecular formula C20H14F3NO4S and a molecular weight of 421.40 g/mol. Its IUPAC name is 4-[[2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 4-[[2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 86600560 |
| Molecular Formula | C20H14F3NO4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 4-[[2-[(E)-2-[4-(trifluoromethylsulfinyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCc2coc(/C=C/c3ccc(S(=O)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H14F3NO4S/c21-20(22,23)29(26)18-8-3-14(4-9-18)5-10-19-24-16(13-28-19)12-27-17-6-1-15(11-25)2-7-17/h1-11,13H,12H2/b10-5+ |
| InChIKey | IKQRYLUQKMFYDL-BJMVGYQFSA-N |
| XLogP | 4.86 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|