C21H28N2O7 — CID 162336897
1-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone;oxalic acid (PubChem CID 162336897) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 1-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone;oxalic acid.
| Compound Name | 1-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone;oxalic acid |
|---|---|
| PubChem CID | 162336897 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone;oxalic acid |
| SMILES | O=C(CN1CCOCC1)N1CCC(/C=C/c2ccc(O)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26N2O3.C2H2O4/c22-18-5-3-16(4-6-18)1-2-17-7-9-21(10-8-17)19(23)15-20-11-13-24-14-12-20;3-1(4)2(5)6/h1-6,17,22H,7-15H2;(H,3,4)(H,5,6)/b2-1+; |
| InChIKey | QKCJTUTVJKLOJQ-TYYBGVCCSA-N |
| XLogP | 1.13 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|