C19H25BrN2O2 — CID 59686441
1-[4-[(E)-2-(2-bromophenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 59686441) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 1-[4-[(E)-2-(2-bromophenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[4-[(E)-2-(2-bromophenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 59686441 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[4-[(E)-2-(2-bromophenyl)ethenyl]piperidin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCOCC1)N1CCC(/C=C/c2ccccc2Br)CC1 |
| InChI | InChI=1S/C19H25BrN2O2/c20-18-4-2-1-3-17(18)6-5-16-7-9-22(10-8-16)19(23)15-21-11-13-24-14-12-21/h1-6,16H,7-15H2/b6-5+ |
| InChIKey | GAFHDBNIXBAFSH-AATRIKPKSA-N |
| XLogP | 3.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |