C22H24Cl2N2O — CID 162340373
8-chloro-6-[1-[(4-methylphenyl)methyl]piperidin-4-yl]oxyisoquinoline;hydrochloride (PubChem CID 162340373) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is 8-chloro-6-[1-[(4-methylphenyl)methyl]piperidin-4-yl]oxyisoquinoline;hydrochloride.
| Compound Name | 8-chloro-6-[1-[(4-methylphenyl)methyl]piperidin-4-yl]oxyisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 162340373 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 8-chloro-6-[1-[(4-methylphenyl)methyl]piperidin-4-yl]oxyisoquinoline;hydrochloride |
| SMILES | Cc1ccc(CN2CCC(Oc3cc(Cl)c4cnccc4c3)CC2)cc1.Cl |
| InChI | InChI=1S/C22H23ClN2O.ClH/c1-16-2-4-17(5-3-16)15-25-10-7-19(8-11-25)26-20-12-18-6-9-24-14-21(18)22(23)13-20;/h2-6,9,12-14,19H,7-8,10-11,15H2,1H3;1H |
| InChIKey | BRDICCPXNCDQSV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |