C19H26Cl2N2O — CID 162335979
8-chloro-6-[1-(3-methylbutyl)piperidin-4-yl]oxyisoquinoline;hydrochloride (PubChem CID 162335979) has the molecular formula C19H26Cl2N2O and a molecular weight of 369.34 g/mol. Its IUPAC name is 8-chloro-6-[1-(3-methylbutyl)piperidin-4-yl]oxyisoquinoline;hydrochloride.
| Compound Name | 8-chloro-6-[1-(3-methylbutyl)piperidin-4-yl]oxyisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 162335979 |
| Molecular Formula | C19H26Cl2N2O |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 8-chloro-6-[1-(3-methylbutyl)piperidin-4-yl]oxyisoquinoline;hydrochloride |
| SMILES | CC(C)CCN1CCC(Oc2cc(Cl)c3cnccc3c2)CC1.Cl |
| InChI | InChI=1S/C19H25ClN2O.ClH/c1-14(2)4-8-22-9-5-16(6-10-22)23-17-11-15-3-7-21-13-18(15)19(20)12-17;/h3,7,11-14,16H,4-6,8-10H2,1-2H3;1H |
| InChIKey | KAKYYIBBSZLARB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |