C9H11BrF2O2 — CID 162341501
ethyl 2-(3-bromo-1-bicyclo[1.1.1]pentanyl)-2,2-difluoroacetate (PubChem CID 162341501) has the molecular formula C9H11BrF2O2 and a molecular weight of 269.08 g/mol. Its IUPAC name is ethyl 2-(3-bromo-1-bicyclo[1.1.1]pentanyl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(3-bromo-1-bicyclo[1.1.1]pentanyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162341501 |
| Molecular Formula | C9H11BrF2O2 |
| Molecular Weight | 269.08 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | ethyl 2-(3-bromo-1-bicyclo[1.1.1]pentanyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)C12CC(Br)(C1)C2 |
| InChI | InChI=1S/C9H11BrF2O2/c1-2-14-6(13)9(11,12)7-3-8(10,4-7)5-7/h2-5H2,1H3 |
| InChIKey | IMSHADVTEHBWRJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|