About (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride
(2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride (PubChem CID 162342302) has the molecular formula C9H20Cl2N2
and a molecular weight of 227.18 g/mol. Its IUPAC name is (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride |
| PubChem CID | 162342302 |
| Molecular Formula | C9H20Cl2N2 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride |
| SMILES | C[C@H]1CN(C2CC2)[C@@H](C)CN1.Cl.Cl |
| InChI | InChI=1S/C9H18N2.2ClH/c1-7-6-11(9-3-4-9)8(2)5-10-7;;/h7-10H,3-6H2,1-2H3;2*1H/t7-,8-;;/m0../s1 |
| InChIKey | MEGNUPSRDMONGU-FOMWZSOGSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride?
The IUPAC name of (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride (CID 162342302) is (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride.
What is the SMILES notation for (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride?
The canonical SMILES for (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride is C[C@H]1CN(C2CC2)[C@@H](C)CN1.Cl.Cl.
What is the InChIKey of (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride?
The InChIKey is MEGNUPSRDMONGU-FOMWZSOGSA-N. The full InChI is InChI=1S/C9H18N2.2ClH/c1-7-6-11(9-3-4-9)8(2)5-10-7;;/h7-10H,3-6H2,1-2H3;2*1H/t7-,8-;;/m0../s1.
What are the key properties of (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride?
(2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride has a molecular weight of 227.18 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-cyclopropyl-2,5-dimethylpiperazine;dihydrochloride is sourced from PubChem (CID 162342302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).