C9H18N2 — CID 64954280
1-cyclopropyl-2,5-dimethylpiperazine (PubChem CID 64954280) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-cyclopropyl-2,5-dimethylpiperazine.
| Compound Name | 1-cyclopropyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64954280 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-cyclopropyl-2,5-dimethylpiperazine |
| SMILES | CC1CN(C2CC2)C(C)CN1 |
| InChI | InChI=1S/C9H18N2/c1-7-6-11(9-3-4-9)8(2)5-10-7/h7-10H,3-6H2,1-2H3 |
| InChIKey | VIVZKTDDLQPRRE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |