C14H18N2O3 — CID 162342912
tert-butyl 6-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate (PubChem CID 162342912) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl 6-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate.
| Compound Name | tert-butyl 6-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 162342912 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | tert-butyl 6-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ncccc2CC1C=O |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)19-13(18)16-8-12-10(5-4-6-15-12)7-11(16)9-17/h4-6,9,11H,7-8H2,1-3H3 |
| InChIKey | SFQZNBFKWKGJLL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|