C14H21ClN2O2 — CID 162344541
(3R)-3-amino-3-(4-piperidin-1-ylphenyl)propanoic acid;hydrochloride (PubChem CID 162344541) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (3R)-3-amino-3-(4-piperidin-1-ylphenyl)propanoic acid;hydrochloride.
| Compound Name | (3R)-3-amino-3-(4-piperidin-1-ylphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162344541 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3R)-3-amino-3-(4-piperidin-1-ylphenyl)propanoic acid;hydrochloride |
| SMILES | Cl.N[C@H](CC(=O)O)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C14H20N2O2.ClH/c15-13(10-14(17)18)11-4-6-12(7-5-11)16-8-2-1-3-9-16;/h4-7,13H,1-3,8-10,15H2,(H,17,18);1H/t13-;/m1./s1 |
| InChIKey | OQFFOCCRGIZGLZ-BTQNPOSSSA-N |
| XLogP | 2.57 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|