C28H32Cl2I4N6O12 — CID 162345328
4-chloro-5-[[2-chloro-3,5-bis(1,3-dihydroxypropan-2-ylcarbamoyl)-4,6-diiodophenyl]diazenyl]-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,6-diiodobenzene-1,3-dicarboxamide (PubChem CID 162345328) has the molecular formula C28H32Cl2I4N6O12 and a molecular weight of 1223.12 g/mol. Its IUPAC name is 4-chloro-5-[[2-chloro-3,5-bis(1,3-dihydroxypropan-2-ylcarbamoyl)-4,6-diiodophenyl]diazenyl]-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,6-diiodobenzene-1,3-dicarboxamide.
| Compound Name | 4-chloro-5-[[2-chloro-3,5-bis(1,3-dihydroxypropan-2-ylcarbamoyl)-4,6-diiodophenyl]diazenyl]-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,6-diiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 162345328 |
| Molecular Formula | C28H32Cl2I4N6O12 |
| Molecular Weight | 1223.12 g/mol |
| Exact Mass | 1221.76 |
| IUPAC Name | 4-chloro-5-[[2-chloro-3,5-bis(1,3-dihydroxypropan-2-ylcarbamoyl)-4,6-diiodophenyl]diazenyl]-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,6-diiodobenzene-1,3-dicarboxamide |
| SMILES | O=C(NC(CO)CO)c1c(Cl)c(/N=N/c2c(Cl)c(C(=O)NC(CO)CO)c(I)c(C(=O)NC(CO)CO)c2I)c(I)c(C(=O)NC(CO)CO)c1I |
| InChI | InChI=1S/C28H32Cl2I4N6O12/c29-17-13(25(49)35-9(1-41)2-42)19(31)15(27(51)37-11(5-45)6-46)21(33)23(17)39-40-24-18(30)14(26(50)36-10(3-43)4-44)20(32)16(22(24)34)28(52)38-12(7-47)8-48/h9-12,41-48H,1-8H2,(H,35,49)(H,36,50)(H,37,51)(H,38,52)/b40-39+ |
| InChIKey | MPYMVIBDCDAXFM-XQQUEIPISA-N |
| XLogP | 0.16 |
| TPSA | 302.96 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1223.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|